C6H9NO3 — CID 154006806
2,2-dimethyl-1,3-oxazinane-4,6-dione (PubChem CID 154006806) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-oxazinane-4,6-dione.
| Compound Name | 2,2-dimethyl-1,3-oxazinane-4,6-dione |
|---|---|
| PubChem CID | 154006806 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 2,2-dimethyl-1,3-oxazinane-4,6-dione |
| SMILES | CC1(C)NC(=O)CC(=O)O1 |
| InChI | InChI=1S/C6H9NO3/c1-6(2)7-4(8)3-5(9)10-6/h3H2,1-2H3,(H,7,8) |
| InChIKey | ODCJAVCSVNOBGS-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|