C8H15N3 — CID 154007283
(1-methyl-4-methyliminopiperidin-3-ylidene)methanamine (PubChem CID 154007283) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is (1-methyl-4-methyliminopiperidin-3-ylidene)methanamine.
| Compound Name | (1-methyl-4-methyliminopiperidin-3-ylidene)methanamine |
|---|---|
| PubChem CID | 154007283 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | (1-methyl-4-methyliminopiperidin-3-ylidene)methanamine |
| SMILES | C/N=C1\CCN(C)CC1=CN |
| InChI | InChI=1S/C8H15N3/c1-10-8-3-4-11(2)6-7(8)5-9/h5H,3-4,6,9H2,1-2H3/b7-5?,10-8+ |
| InChIKey | UXQJEMMMADDPOG-QSKBLMOKSA-N |
| XLogP | 0.24 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|