About 2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-2-methylpropanedithioic acid
2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-2-methylpropanedithioic acid (PubChem CID 15400894) has the molecular formula C9H17N2S2+
and a molecular weight of 217.38 g/mol. Its IUPAC name is 2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-2-methylpropanedithioic acid.
Molecular Properties
| Compound Name | 2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-2-methylpropanedithioic acid |
| PubChem CID | 15400894 |
| Molecular Formula | C9H17N2S2+ |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-2-methylpropanedithioic acid |
| SMILES | CN1CC[N+](C)=C1C(C)(C)C(=S)S |
| InChI | InChI=1S/C9H16N2S2/c1-9(2,8(12)13)7-10(3)5-6-11(7)4/h5-6H2,1-4H3/p+1 |
| InChIKey | WIVOREXUKTXGPI-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 6.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-2-methylpropanedithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-2-methylpropanedithioic acid?
The IUPAC name of 2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-2-methylpropanedithioic acid (CID 15400894) is 2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-2-methylpropanedithioic acid.
What is the SMILES notation for 2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-2-methylpropanedithioic acid?
The canonical SMILES for 2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-2-methylpropanedithioic acid is CN1CC[N+](C)=C1C(C)(C)C(=S)S.
What is the InChIKey of 2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-2-methylpropanedithioic acid?
The InChIKey is WIVOREXUKTXGPI-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H16N2S2/c1-9(2,8(12)13)7-10(3)5-6-11(7)4/h5-6H2,1-4H3/p+1.
What are the key properties of 2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-2-methylpropanedithioic acid?
2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-2-methylpropanedithioic acid has a molecular weight of 217.38 g/mol, XLogP of 1.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethyl-4,5-dihydroimidazol-1-ium-2-yl)-2-methylpropanedithioic acid is sourced from PubChem (CID 15400894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).