About (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid
(2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid (PubChem CID 154008980) has the molecular formula C14H23F2NO4
and a molecular weight of 307.34 g/mol. Its IUPAC name is (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid.
Molecular Properties
| Compound Name | (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid |
| PubChem CID | 154008980 |
| Molecular Formula | C14H23F2NO4 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid |
| SMILES | C=CCCC(F)(F)CC[C@@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H23F2NO4/c1-5-6-8-14(15,16)9-7-10(11(18)19)17-12(20)21-13(2,3)4/h5,10H,1,6-9H2,2-4H3,(H,17,20)(H,18,19)/t10-/m1/s1 |
| InChIKey | YCIFJCXHXWVFCY-SNVBAGLBSA-N |
| XLogP | 3.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid?
The IUPAC name of (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid (CID 154008980) is (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid.
What is the SMILES notation for (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid?
The canonical SMILES for (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid is C=CCCC(F)(F)CC[C@@H](NC(=O)OC(C)(C)C)C(=O)O.
What is the InChIKey of (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid?
The InChIKey is YCIFJCXHXWVFCY-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H23F2NO4/c1-5-6-8-14(15,16)9-7-10(11(18)19)17-12(20)21-13(2,3)4/h5,10H,1,6-9H2,2-4H3,(H,17,20)(H,18,19)/t10-/m1/s1.
What are the key properties of (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid?
(2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid has a molecular weight of 307.34 g/mol, XLogP of 3.35, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid is sourced from PubChem (CID 154008980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).