About (1S)-1-[(3'R)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol
(1S)-1-[(3'R)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol (PubChem CID 15400902) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is (1S)-1-[(3'R)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol.
Molecular Properties
| Compound Name | (1S)-1-[(3'R)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol |
| PubChem CID | 15400902 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (1S)-1-[(3'R)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol |
| SMILES | C[C@H](O)[C@H]1OOC12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C13H20O3/c1-7(14)12-13(16-15-12)10-3-8-2-9(5-10)6-11(13)4-8/h7-12,14H,2-6H2,1H3/t7-,8?,9?,10?,11?,12+,13?/m0/s1 |
| InChIKey | RZJDGJXXINEQKN-MYWFBKETSA-N |
| XLogP | 1.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-[(3'R)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(3'R)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol?
The IUPAC name of (1S)-1-[(3'R)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol (CID 15400902) is (1S)-1-[(3'R)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol.
What is the SMILES notation for (1S)-1-[(3'R)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol?
The canonical SMILES for (1S)-1-[(3'R)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol is C[C@H](O)[C@H]1OOC12C1CC3CC(C1)CC2C3.
What is the InChIKey of (1S)-1-[(3'R)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol?
The InChIKey is RZJDGJXXINEQKN-MYWFBKETSA-N. The full InChI is InChI=1S/C13H20O3/c1-7(14)12-13(16-15-12)10-3-8-2-9(5-10)6-11(13)4-8/h7-12,14H,2-6H2,1H3/t7-,8?,9?,10?,11?,12+,13?/m0/s1.
What are the key properties of (1S)-1-[(3'R)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol?
(1S)-1-[(3'R)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol has a molecular weight of 224.30 g/mol, XLogP of 1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(3'R)-spiro[adamantane-2,4'-dioxetane]-3'-yl]ethanol is sourced from PubChem (CID 15400902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).