About 2-propan-2-yl-1,3-dioxa-6-azanida-2-boracyclooctane;rhenium
2-propan-2-yl-1,3-dioxa-6-azanida-2-boracyclooctane;rhenium (PubChem CID 154009224) has the molecular formula C7H15BNO2Re-
and a molecular weight of 342.22 g/mol. Its IUPAC name is 2-propan-2-yl-1,3-dioxa-6-azanida-2-boracyclooctane;rhenium.
Molecular Properties
| Compound Name | 2-propan-2-yl-1,3-dioxa-6-azanida-2-boracyclooctane;rhenium |
| PubChem CID | 154009224 |
| Molecular Formula | C7H15BNO2Re- |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2-propan-2-yl-1,3-dioxa-6-azanida-2-boracyclooctane;rhenium |
| SMILES | CC(C)B1OCC[N-]CCO1.[Re] |
| InChI | InChI=1S/C7H15BNO2.Re/c1-7(2)8-10-5-3-9-4-6-11-8;/h7H,3-6H2,1-2H3;/q-1; |
| InChIKey | PKKCWXDDWBHBEC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 32.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yl-1,3-dioxa-6-azanida-2-boracyclooctane;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-1,3-dioxa-6-azanida-2-boracyclooctane;rhenium?
The IUPAC name of 2-propan-2-yl-1,3-dioxa-6-azanida-2-boracyclooctane;rhenium (CID 154009224) is 2-propan-2-yl-1,3-dioxa-6-azanida-2-boracyclooctane;rhenium.
What is the SMILES notation for 2-propan-2-yl-1,3-dioxa-6-azanida-2-boracyclooctane;rhenium?
The canonical SMILES for 2-propan-2-yl-1,3-dioxa-6-azanida-2-boracyclooctane;rhenium is CC(C)B1OCC[N-]CCO1.[Re].
What is the InChIKey of 2-propan-2-yl-1,3-dioxa-6-azanida-2-boracyclooctane;rhenium?
The InChIKey is PKKCWXDDWBHBEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15BNO2.Re/c1-7(2)8-10-5-3-9-4-6-11-8;/h7H,3-6H2,1-2H3;/q-1;.
What are the key properties of 2-propan-2-yl-1,3-dioxa-6-azanida-2-boracyclooctane;rhenium?
2-propan-2-yl-1,3-dioxa-6-azanida-2-boracyclooctane;rhenium has a molecular weight of 342.22 g/mol, XLogP of 1.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-1,3-dioxa-6-azanida-2-boracyclooctane;rhenium is sourced from PubChem (CID 154009224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).