C11H10F7NU — CID 154012347
2,2,3,3-tetrafluoropentane;5-(trifluoromethyl)-2H-pyridin-2-ide;uranium(2+) (PubChem CID 154012347) has the molecular formula C11H10F7NU and a molecular weight of 527.22 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropentane;5-(trifluoromethyl)-2H-pyridin-2-ide;uranium(2+).
| Compound Name | 2,2,3,3-tetrafluoropentane;5-(trifluoromethyl)-2H-pyridin-2-ide;uranium(2+) |
|---|---|
| PubChem CID | 154012347 |
| Molecular Formula | C11H10F7NU |
| Molecular Weight | 527.22 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 2,2,3,3-tetrafluoropentane;5-(trifluoromethyl)-2H-pyridin-2-ide;uranium(2+) |
| SMILES | FC(F)(F)c1cc[c-]nc1.[CH2-]C(F)(F)C(F)(F)CC.[U+2] |
| InChI | InChI=1S/C6H3F3N.C5H7F4.U/c7-6(8,9)5-2-1-3-10-4-5;1-3-5(8,9)4(2,6)7;/h1-2,4H;2-3H2,1H3;/q2*-1;+2 |
| InChIKey | VSOUDKFSZVMKCX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.22 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|