About hexa-1,3-dienylcarbamic acid
hexa-1,3-dienylcarbamic acid (PubChem CID 154013072) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is hexa-1,3-dienylcarbamic acid.
Molecular Properties
| Compound Name | hexa-1,3-dienylcarbamic acid |
| PubChem CID | 154013072 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | hexa-1,3-dienylcarbamic acid |
| SMILES | CCC=CC=CNC(=O)O |
| InChI | InChI=1S/C7H11NO2/c1-2-3-4-5-6-8-7(9)10/h3-6,8H,2H2,1H3,(H,9,10) |
| InChIKey | ULDDYNDCWDTMFD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze hexa-1,3-dienylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-1,3-dienylcarbamic acid?
The IUPAC name of hexa-1,3-dienylcarbamic acid (CID 154013072) is hexa-1,3-dienylcarbamic acid.
What is the SMILES notation for hexa-1,3-dienylcarbamic acid?
The canonical SMILES for hexa-1,3-dienylcarbamic acid is CCC=CC=CNC(=O)O.
What is the InChIKey of hexa-1,3-dienylcarbamic acid?
The InChIKey is ULDDYNDCWDTMFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-2-3-4-5-6-8-7(9)10/h3-6,8H,2H2,1H3,(H,9,10).
What are the key properties of hexa-1,3-dienylcarbamic acid?
hexa-1,3-dienylcarbamic acid has a molecular weight of 141.17 g/mol, XLogP of 1.73, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-1,3-dienylcarbamic acid is sourced from PubChem (CID 154013072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).