C16H24F3N3O — CID 154015508
2-octan-3-yl-8-(trifluoromethyl)-6,7,8,9-tetrahydropyrimido[1,2-a]pyrimidin-4-one (PubChem CID 154015508) has the molecular formula C16H24F3N3O and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-octan-3-yl-8-(trifluoromethyl)-6,7,8,9-tetrahydropyrimido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-octan-3-yl-8-(trifluoromethyl)-6,7,8,9-tetrahydropyrimido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 154015508 |
| Molecular Formula | C16H24F3N3O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 2-octan-3-yl-8-(trifluoromethyl)-6,7,8,9-tetrahydropyrimido[1,2-a]pyrimidin-4-one |
| SMILES | CCCCCC(CC)c1cc(=O)n2c(n1)NC(C(F)(F)F)CC2 |
| InChI | InChI=1S/C16H24F3N3O/c1-3-5-6-7-11(4-2)12-10-14(23)22-9-8-13(16(17,18)19)21-15(22)20-12/h10-11,13H,3-9H2,1-2H3,(H,20,21) |
| InChIKey | COHOJZVPFFUWID-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|