C14H18O6 — CID 15401612
methyl (1R,2R,6R,7R)-11,11-dimethoxy-10-oxo-3-oxatricyclo[5.2.2.02,6]undec-8-ene-8-carboxylate (PubChem CID 15401612) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is methyl (1R,2R,6R,7R)-11,11-dimethoxy-10-oxo-3-oxatricyclo[5.2.2.02,6]undec-8-ene-8-carboxylate.
| Compound Name | methyl (1R,2R,6R,7R)-11,11-dimethoxy-10-oxo-3-oxatricyclo[5.2.2.02,6]undec-8-ene-8-carboxylate |
|---|---|
| PubChem CID | 15401612 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | methyl (1R,2R,6R,7R)-11,11-dimethoxy-10-oxo-3-oxatricyclo[5.2.2.02,6]undec-8-ene-8-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2C(=O)C(OC)(OC)[C@@H]1[C@H]1CCO[C@H]12 |
| InChI | InChI=1S/C14H18O6/c1-17-13(16)8-6-9-11-7(4-5-20-11)10(8)14(18-2,19-3)12(9)15/h6-7,9-11H,4-5H2,1-3H3/t7-,9-,10-,11-/m1/s1 |
| InChIKey | HHMUBRPIEXAVGF-QCNRFFRDSA-N |
| XLogP | 0.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|