About 2-oxoindole-3,4-dicarbonitrile
2-oxoindole-3,4-dicarbonitrile (PubChem CID 154016477) has the molecular formula C10H3N3O
and a molecular weight of 181.15 g/mol. Its IUPAC name is 2-oxoindole-3,4-dicarbonitrile.
Molecular Properties
| Compound Name | 2-oxoindole-3,4-dicarbonitrile |
| PubChem CID | 154016477 |
| Molecular Formula | C10H3N3O |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 2-oxoindole-3,4-dicarbonitrile |
| SMILES | N#CC1=c2c(C#N)cccc2=NC1=O |
| InChI | InChI=1S/C10H3N3O/c11-4-6-2-1-3-8-9(6)7(5-12)10(14)13-8/h1-3H |
| InChIKey | ONCGCMCWJGJECL-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 77.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxoindole-3,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxoindole-3,4-dicarbonitrile?
The IUPAC name of 2-oxoindole-3,4-dicarbonitrile (CID 154016477) is 2-oxoindole-3,4-dicarbonitrile.
What is the SMILES notation for 2-oxoindole-3,4-dicarbonitrile?
The canonical SMILES for 2-oxoindole-3,4-dicarbonitrile is N#CC1=c2c(C#N)cccc2=NC1=O.
What is the InChIKey of 2-oxoindole-3,4-dicarbonitrile?
The InChIKey is ONCGCMCWJGJECL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H3N3O/c11-4-6-2-1-3-8-9(6)7(5-12)10(14)13-8/h1-3H.
What are the key properties of 2-oxoindole-3,4-dicarbonitrile?
2-oxoindole-3,4-dicarbonitrile has a molecular weight of 181.15 g/mol, XLogP of -0.61, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxoindole-3,4-dicarbonitrile is sourced from PubChem (CID 154016477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).