About quinolizine-2,4-dione
quinolizine-2,4-dione (PubChem CID 154016772) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is quinolizine-2,4-dione.
Molecular Properties
| Compound Name | quinolizine-2,4-dione |
| PubChem CID | 154016772 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | quinolizine-2,4-dione |
| SMILES | O=C1C=C2C=CC=CN2C(=O)C1 |
| InChI | InChI=1S/C9H7NO2/c11-8-5-7-3-1-2-4-10(7)9(12)6-8/h1-5H,6H2 |
| InChIKey | HRMIQNZVYZSJCC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze quinolizine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolizine-2,4-dione?
The IUPAC name of quinolizine-2,4-dione (CID 154016772) is quinolizine-2,4-dione.
What is the SMILES notation for quinolizine-2,4-dione?
The canonical SMILES for quinolizine-2,4-dione is O=C1C=C2C=CC=CN2C(=O)C1.
What is the InChIKey of quinolizine-2,4-dione?
The InChIKey is HRMIQNZVYZSJCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c11-8-5-7-3-1-2-4-10(7)9(12)6-8/h1-5H,6H2.
What are the key properties of quinolizine-2,4-dione?
quinolizine-2,4-dione has a molecular weight of 161.16 g/mol, XLogP of 0.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinolizine-2,4-dione is sourced from PubChem (CID 154016772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).