C48H24F18 — CID 154016845
1,2,3,4,5,6-hexakis[4-(trifluoromethyl)phenyl]benzene (PubChem CID 154016845) has the molecular formula C48H24F18 and a molecular weight of 942.68 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexakis[4-(trifluoromethyl)phenyl]benzene.
| Compound Name | 1,2,3,4,5,6-hexakis[4-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 154016845 |
| Molecular Formula | C48H24F18 |
| Molecular Weight | 942.68 g/mol |
| Exact Mass | 942.16 |
| IUPAC Name | 1,2,3,4,5,6-hexakis[4-(trifluoromethyl)phenyl]benzene |
| SMILES | FC(F)(F)c1ccc(-c2c(-c3ccc(C(F)(F)F)cc3)c(-c3ccc(C(F)(F)F)cc3)c(-c3ccc(C(F)(F)F)cc3)c(-c3ccc(C(F)(F)F)cc3)c2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C48H24F18/c49-43(50,51)31-13-1-25(2-14-31)37-38(26-3-15-32(16-4-26)44(52,53)54)40(28-7-19-34(20-8-28)46(58,59)60)42(30-11-23-36(24-12-30)48(64,65)66)41(29-9-21-35(22-10-29)47(61,62)63)39(37)27-5-17-33(18-6-27)45(55,56)57/h1-24H |
| InChIKey | WZFLBWUZELQTGZ-UHFFFAOYSA-N |
| XLogP | 17.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.68 |
| LogP ≤ 5 | 17.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |