C16H16N4O — CID 15401709
3-butyl-2,4,5,8-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaen-7-one (PubChem CID 15401709) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-butyl-2,4,5,8-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaen-7-one.
| Compound Name | 3-butyl-2,4,5,8-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaen-7-one |
|---|---|
| PubChem CID | 15401709 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3-butyl-2,4,5,8-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaen-7-one |
| SMILES | CCCCc1nnc2c(=O)[nH]c3c(n12)Cc1ccccc1-3 |
| InChI | InChI=1S/C16H16N4O/c1-2-3-8-13-18-19-15-16(21)17-14-11-7-5-4-6-10(11)9-12(14)20(13)15/h4-7H,2-3,8-9H2,1H3,(H,17,21) |
| InChIKey | RYLQJTDPPYUNBT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |