About 4,5-dimethyl-3-phenyl-1,3-thiazole-2-thione
4,5-dimethyl-3-phenyl-1,3-thiazole-2-thione (PubChem CID 15401860) has the molecular formula C11H11NS2
and a molecular weight of 221.35 g/mol. Its IUPAC name is 4,5-dimethyl-3-phenyl-1,3-thiazole-2-thione.
Molecular Properties
| Compound Name | 4,5-dimethyl-3-phenyl-1,3-thiazole-2-thione |
| PubChem CID | 15401860 |
| Molecular Formula | C11H11NS2 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 4,5-dimethyl-3-phenyl-1,3-thiazole-2-thione |
| SMILES | Cc1sc(=S)n(-c2ccccc2)c1C |
| InChI | InChI=1S/C11H11NS2/c1-8-9(2)14-11(13)12(8)10-6-4-3-5-7-10/h3-7H,1-2H3 |
| InChIKey | DOMBNTYUIQDNHU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-3-phenyl-1,3-thiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3-phenyl-1,3-thiazole-2-thione?
The IUPAC name of 4,5-dimethyl-3-phenyl-1,3-thiazole-2-thione (CID 15401860) is 4,5-dimethyl-3-phenyl-1,3-thiazole-2-thione.
What is the SMILES notation for 4,5-dimethyl-3-phenyl-1,3-thiazole-2-thione?
The canonical SMILES for 4,5-dimethyl-3-phenyl-1,3-thiazole-2-thione is Cc1sc(=S)n(-c2ccccc2)c1C.
What is the InChIKey of 4,5-dimethyl-3-phenyl-1,3-thiazole-2-thione?
The InChIKey is DOMBNTYUIQDNHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NS2/c1-8-9(2)14-11(13)12(8)10-6-4-3-5-7-10/h3-7H,1-2H3.
What are the key properties of 4,5-dimethyl-3-phenyl-1,3-thiazole-2-thione?
4,5-dimethyl-3-phenyl-1,3-thiazole-2-thione has a molecular weight of 221.35 g/mol, XLogP of 3.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3-phenyl-1,3-thiazole-2-thione is sourced from PubChem (CID 15401860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).