About 3-butyl-2H-pyran-2-ol
3-butyl-2H-pyran-2-ol (PubChem CID 154019084) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 3-butyl-2H-pyran-2-ol.
Molecular Properties
| Compound Name | 3-butyl-2H-pyran-2-ol |
| PubChem CID | 154019084 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 3-butyl-2H-pyran-2-ol |
| SMILES | CCCCC1=CC=COC1O |
| InChI | InChI=1S/C9H14O2/c1-2-3-5-8-6-4-7-11-9(8)10/h4,6-7,9-10H,2-3,5H2,1H3 |
| InChIKey | RAURZTDKBLLOIV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butyl-2H-pyran-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-2H-pyran-2-ol?
The IUPAC name of 3-butyl-2H-pyran-2-ol (CID 154019084) is 3-butyl-2H-pyran-2-ol.
What is the SMILES notation for 3-butyl-2H-pyran-2-ol?
The canonical SMILES for 3-butyl-2H-pyran-2-ol is CCCCC1=CC=COC1O.
What is the InChIKey of 3-butyl-2H-pyran-2-ol?
The InChIKey is RAURZTDKBLLOIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-2-3-5-8-6-4-7-11-9(8)10/h4,6-7,9-10H,2-3,5H2,1H3.
What are the key properties of 3-butyl-2H-pyran-2-ol?
3-butyl-2H-pyran-2-ol has a molecular weight of 154.21 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-2H-pyran-2-ol is sourced from PubChem (CID 154019084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).