C21H28N2 — CID 154019465
4-(2,2,6,6-tetramethylacridin-4-yl)butan-1-amine (PubChem CID 154019465) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 4-(2,2,6,6-tetramethylacridin-4-yl)butan-1-amine.
| Compound Name | 4-(2,2,6,6-tetramethylacridin-4-yl)butan-1-amine |
|---|---|
| PubChem CID | 154019465 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 4-(2,2,6,6-tetramethylacridin-4-yl)butan-1-amine |
| SMILES | CC1(C)C=C(CCCCN)c2nc3c(cc2=C1)C=CC(C)(C)C=3 |
| InChI | InChI=1S/C21H28N2/c1-20(2)9-8-15-11-17-13-21(3,4)12-16(7-5-6-10-22)19(17)23-18(15)14-20/h8-9,11-14H,5-7,10,22H2,1-4H3 |
| InChIKey | FSQYJAKBDPHOGD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|