About 1,2-diethoxy-1,2-dimethoxyhydrazine
1,2-diethoxy-1,2-dimethoxyhydrazine (PubChem CID 154020746) has the molecular formula C6H16N2O4
and a molecular weight of 180.20 g/mol. Its IUPAC name is 1,2-diethoxy-1,2-dimethoxyhydrazine.
Molecular Properties
| Compound Name | 1,2-diethoxy-1,2-dimethoxyhydrazine |
| PubChem CID | 154020746 |
| Molecular Formula | C6H16N2O4 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 1,2-diethoxy-1,2-dimethoxyhydrazine |
| SMILES | CCON(OC)N(OC)OCC |
| InChI | InChI=1S/C6H16N2O4/c1-5-11-7(9-3)8(10-4)12-6-2/h5-6H2,1-4H3 |
| InChIKey | NNEANRJUOQHCLB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diethoxy-1,2-dimethoxyhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethoxy-1,2-dimethoxyhydrazine?
The IUPAC name of 1,2-diethoxy-1,2-dimethoxyhydrazine (CID 154020746) is 1,2-diethoxy-1,2-dimethoxyhydrazine.
What is the SMILES notation for 1,2-diethoxy-1,2-dimethoxyhydrazine?
The canonical SMILES for 1,2-diethoxy-1,2-dimethoxyhydrazine is CCON(OC)N(OC)OCC.
What is the InChIKey of 1,2-diethoxy-1,2-dimethoxyhydrazine?
The InChIKey is NNEANRJUOQHCLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2O4/c1-5-11-7(9-3)8(10-4)12-6-2/h5-6H2,1-4H3.
What are the key properties of 1,2-diethoxy-1,2-dimethoxyhydrazine?
1,2-diethoxy-1,2-dimethoxyhydrazine has a molecular weight of 180.20 g/mol, XLogP of 0.53, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethoxy-1,2-dimethoxyhydrazine is sourced from PubChem (CID 154020746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).