About (4-nonoxyphenyl)methyl carbamate
(4-nonoxyphenyl)methyl carbamate (PubChem CID 154021041) has the molecular formula C17H27NO3
and a molecular weight of 293.41 g/mol. Its IUPAC name is (4-nonoxyphenyl)methyl carbamate.
Molecular Properties
| Compound Name | (4-nonoxyphenyl)methyl carbamate |
| PubChem CID | 154021041 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | (4-nonoxyphenyl)methyl carbamate |
| SMILES | CCCCCCCCCOc1ccc(COC(N)=O)cc1 |
| InChI | InChI=1S/C17H27NO3/c1-2-3-4-5-6-7-8-13-20-16-11-9-15(10-12-16)14-21-17(18)19/h9-12H,2-8,13-14H2,1H3,(H2,18,19) |
| InChIKey | UKFIOJOEPKQKNU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-nonoxyphenyl)methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nonoxyphenyl)methyl carbamate?
The IUPAC name of (4-nonoxyphenyl)methyl carbamate (CID 154021041) is (4-nonoxyphenyl)methyl carbamate.
What is the SMILES notation for (4-nonoxyphenyl)methyl carbamate?
The canonical SMILES for (4-nonoxyphenyl)methyl carbamate is CCCCCCCCCOc1ccc(COC(N)=O)cc1.
What is the InChIKey of (4-nonoxyphenyl)methyl carbamate?
The InChIKey is UKFIOJOEPKQKNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO3/c1-2-3-4-5-6-7-8-13-20-16-11-9-15(10-12-16)14-21-17(18)19/h9-12H,2-8,13-14H2,1H3,(H2,18,19).
What are the key properties of (4-nonoxyphenyl)methyl carbamate?
(4-nonoxyphenyl)methyl carbamate has a molecular weight of 293.41 g/mol, XLogP of 4.41, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nonoxyphenyl)methyl carbamate is sourced from PubChem (CID 154021041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).