About 5,7-diphenyl-1,2,3-benzoselenadiazole
5,7-diphenyl-1,2,3-benzoselenadiazole (PubChem CID 15402126) has the molecular formula C18H12N2Se
and a molecular weight of 335.27 g/mol. Its IUPAC name is 5,7-diphenyl-1,2,3-benzoselenadiazole.
Molecular Properties
| Compound Name | 5,7-diphenyl-1,2,3-benzoselenadiazole |
| PubChem CID | 15402126 |
| Molecular Formula | C18H12N2Se |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 5,7-diphenyl-1,2,3-benzoselenadiazole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)c3[se]nnc3c2)cc1 |
| InChI | InChI=1S/C18H12N2Se/c1-3-7-13(8-4-1)15-11-16(14-9-5-2-6-10-14)18-17(12-15)19-20-21-18/h1-12H |
| InChIKey | ULOBMPXMOQHBFE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5,7-diphenyl-1,2,3-benzoselenadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-diphenyl-1,2,3-benzoselenadiazole?
The IUPAC name of 5,7-diphenyl-1,2,3-benzoselenadiazole (CID 15402126) is 5,7-diphenyl-1,2,3-benzoselenadiazole.
What is the SMILES notation for 5,7-diphenyl-1,2,3-benzoselenadiazole?
The canonical SMILES for 5,7-diphenyl-1,2,3-benzoselenadiazole is c1ccc(-c2cc(-c3ccccc3)c3[se]nnc3c2)cc1.
What is the InChIKey of 5,7-diphenyl-1,2,3-benzoselenadiazole?
The InChIKey is ULOBMPXMOQHBFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2Se/c1-3-7-13(8-4-1)15-11-16(14-9-5-2-6-10-14)18-17(12-15)19-20-21-18/h1-12H.
What are the key properties of 5,7-diphenyl-1,2,3-benzoselenadiazole?
5,7-diphenyl-1,2,3-benzoselenadiazole has a molecular weight of 335.27 g/mol, XLogP of 4.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-diphenyl-1,2,3-benzoselenadiazole is sourced from PubChem (CID 15402126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).