About 1,4-difluorobut-2-enyl hydrogen carbonate
1,4-difluorobut-2-enyl hydrogen carbonate (PubChem CID 154021651) has the molecular formula C5H6F2O3
and a molecular weight of 152.10 g/mol. Its IUPAC name is 1,4-difluorobut-2-enyl hydrogen carbonate.
Molecular Properties
| Compound Name | 1,4-difluorobut-2-enyl hydrogen carbonate |
| PubChem CID | 154021651 |
| Molecular Formula | C5H6F2O3 |
| Molecular Weight | 152.10 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | 1,4-difluorobut-2-enyl hydrogen carbonate |
| SMILES | O=C(O)OC(F)C=CCF |
| InChI | InChI=1S/C5H6F2O3/c6-3-1-2-4(7)10-5(8)9/h1-2,4H,3H2,(H,8,9) |
| InChIKey | HBKGXENOGOVUBT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.10 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,4-difluorobut-2-enyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-difluorobut-2-enyl hydrogen carbonate?
The IUPAC name of 1,4-difluorobut-2-enyl hydrogen carbonate (CID 154021651) is 1,4-difluorobut-2-enyl hydrogen carbonate.
What is the SMILES notation for 1,4-difluorobut-2-enyl hydrogen carbonate?
The canonical SMILES for 1,4-difluorobut-2-enyl hydrogen carbonate is O=C(O)OC(F)C=CCF.
What is the InChIKey of 1,4-difluorobut-2-enyl hydrogen carbonate?
The InChIKey is HBKGXENOGOVUBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F2O3/c6-3-1-2-4(7)10-5(8)9/h1-2,4H,3H2,(H,8,9).
What are the key properties of 1,4-difluorobut-2-enyl hydrogen carbonate?
1,4-difluorobut-2-enyl hydrogen carbonate has a molecular weight of 152.10 g/mol, XLogP of 1.50, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-difluorobut-2-enyl hydrogen carbonate is sourced from PubChem (CID 154021651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).