About trans-(1R,3R)-1-tert-butyl-3-(1,1-difluoroethyl)cyclopentane
trans-(1R,3R)-1-tert-butyl-3-(1,1-difluoroethyl)cyclopentane (PubChem CID 15402166) has the molecular formula C11H20F2
and a molecular weight of 190.28 g/mol. Its IUPAC name is trans-(1R,3R)-1-tert-butyl-3-(1,1-difluoroethyl)cyclopentane.
Molecular Properties
| Compound Name | trans-(1R,3R)-1-tert-butyl-3-(1,1-difluoroethyl)cyclopentane |
| PubChem CID | 15402166 |
| Molecular Formula | C11H20F2 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | trans-(1R,3R)-1-tert-butyl-3-(1,1-difluoroethyl)cyclopentane |
| SMILES | CC(C)(C)[C@@H]1CC[C@@H](C(C)(F)F)C1 |
| InChI | InChI=1S/C11H20F2/c1-10(2,3)8-5-6-9(7-8)11(4,12)13/h8-9H,5-7H2,1-4H3/t8-,9-/m1/s1 |
| InChIKey | CRIDWAOYGOVFGZ-RKDXNWHRSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze trans-(1R,3R)-1-tert-butyl-3-(1,1-difluoroethyl)cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,3R)-1-tert-butyl-3-(1,1-difluoroethyl)cyclopentane?
The IUPAC name of trans-(1R,3R)-1-tert-butyl-3-(1,1-difluoroethyl)cyclopentane (CID 15402166) is trans-(1R,3R)-1-tert-butyl-3-(1,1-difluoroethyl)cyclopentane.
What is the SMILES notation for trans-(1R,3R)-1-tert-butyl-3-(1,1-difluoroethyl)cyclopentane?
The canonical SMILES for trans-(1R,3R)-1-tert-butyl-3-(1,1-difluoroethyl)cyclopentane is CC(C)(C)[C@@H]1CC[C@@H](C(C)(F)F)C1.
What is the InChIKey of trans-(1R,3R)-1-tert-butyl-3-(1,1-difluoroethyl)cyclopentane?
The InChIKey is CRIDWAOYGOVFGZ-RKDXNWHRSA-N. The full InChI is InChI=1S/C11H20F2/c1-10(2,3)8-5-6-9(7-8)11(4,12)13/h8-9H,5-7H2,1-4H3/t8-,9-/m1/s1.
What are the key properties of trans-(1R,3R)-1-tert-butyl-3-(1,1-difluoroethyl)cyclopentane?
trans-(1R,3R)-1-tert-butyl-3-(1,1-difluoroethyl)cyclopentane has a molecular weight of 190.28 g/mol, XLogP of 4.10, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,3R)-1-tert-butyl-3-(1,1-difluoroethyl)cyclopentane is sourced from PubChem (CID 15402166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).