About 2-[(2S,4S)-1-tert-butyl-4-methylpyrrolidin-2-yl]-5-iodo-1H-imidazole
2-[(2S,4S)-1-tert-butyl-4-methylpyrrolidin-2-yl]-5-iodo-1H-imidazole (PubChem CID 154022084) has the molecular formula C12H20IN3
and a molecular weight of 333.22 g/mol. Its IUPAC name is 2-[(2S,4S)-1-tert-butyl-4-methylpyrrolidin-2-yl]-5-iodo-1H-imidazole.
Molecular Properties
| Compound Name | 2-[(2S,4S)-1-tert-butyl-4-methylpyrrolidin-2-yl]-5-iodo-1H-imidazole |
| PubChem CID | 154022084 |
| Molecular Formula | C12H20IN3 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-[(2S,4S)-1-tert-butyl-4-methylpyrrolidin-2-yl]-5-iodo-1H-imidazole |
| SMILES | C[C@H]1C[C@@H](c2ncc(I)[nH]2)N(C(C)(C)C)C1 |
| InChI | InChI=1S/C12H20IN3/c1-8-5-9(11-14-6-10(13)15-11)16(7-8)12(2,3)4/h6,8-9H,5,7H2,1-4H3,(H,14,15)/t8-,9-/m0/s1 |
| InChIKey | UTAFXAOCHVXHQY-IUCAKERBSA-N |
| XLogP | 3.20 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S,4S)-1-tert-butyl-4-methylpyrrolidin-2-yl]-5-iodo-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,4S)-1-tert-butyl-4-methylpyrrolidin-2-yl]-5-iodo-1H-imidazole?
The IUPAC name of 2-[(2S,4S)-1-tert-butyl-4-methylpyrrolidin-2-yl]-5-iodo-1H-imidazole (CID 154022084) is 2-[(2S,4S)-1-tert-butyl-4-methylpyrrolidin-2-yl]-5-iodo-1H-imidazole.
What is the SMILES notation for 2-[(2S,4S)-1-tert-butyl-4-methylpyrrolidin-2-yl]-5-iodo-1H-imidazole?
The canonical SMILES for 2-[(2S,4S)-1-tert-butyl-4-methylpyrrolidin-2-yl]-5-iodo-1H-imidazole is C[C@H]1C[C@@H](c2ncc(I)[nH]2)N(C(C)(C)C)C1.
What is the InChIKey of 2-[(2S,4S)-1-tert-butyl-4-methylpyrrolidin-2-yl]-5-iodo-1H-imidazole?
The InChIKey is UTAFXAOCHVXHQY-IUCAKERBSA-N. The full InChI is InChI=1S/C12H20IN3/c1-8-5-9(11-14-6-10(13)15-11)16(7-8)12(2,3)4/h6,8-9H,5,7H2,1-4H3,(H,14,15)/t8-,9-/m0/s1.
What are the key properties of 2-[(2S,4S)-1-tert-butyl-4-methylpyrrolidin-2-yl]-5-iodo-1H-imidazole?
2-[(2S,4S)-1-tert-butyl-4-methylpyrrolidin-2-yl]-5-iodo-1H-imidazole has a molecular weight of 333.22 g/mol, XLogP of 3.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,4S)-1-tert-butyl-4-methylpyrrolidin-2-yl]-5-iodo-1H-imidazole is sourced from PubChem (CID 154022084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).