About triazolo[1,5-a]pyridin-4-ol
triazolo[1,5-a]pyridin-4-ol (PubChem CID 154022157) has the molecular formula C6H5N3O
and a molecular weight of 135.13 g/mol. Its IUPAC name is triazolo[1,5-a]pyridin-4-ol.
Molecular Properties
| Compound Name | triazolo[1,5-a]pyridin-4-ol |
| PubChem CID | 154022157 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | triazolo[1,5-a]pyridin-4-ol |
| SMILES | Oc1cccn2nncc12 |
| InChI | InChI=1S/C6H5N3O/c10-6-2-1-3-9-5(6)4-7-8-9/h1-4,10H |
| InChIKey | KJDXGVKVQMCMMI-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze triazolo[1,5-a]pyridin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triazolo[1,5-a]pyridin-4-ol?
The IUPAC name of triazolo[1,5-a]pyridin-4-ol (CID 154022157) is triazolo[1,5-a]pyridin-4-ol.
What is the SMILES notation for triazolo[1,5-a]pyridin-4-ol?
The canonical SMILES for triazolo[1,5-a]pyridin-4-ol is Oc1cccn2nncc12.
What is the InChIKey of triazolo[1,5-a]pyridin-4-ol?
The InChIKey is KJDXGVKVQMCMMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O/c10-6-2-1-3-9-5(6)4-7-8-9/h1-4,10H.
What are the key properties of triazolo[1,5-a]pyridin-4-ol?
triazolo[1,5-a]pyridin-4-ol has a molecular weight of 135.13 g/mol, XLogP of 0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for triazolo[1,5-a]pyridin-4-ol is sourced from PubChem (CID 154022157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).