C37H28F6O6 — CID 154023180
3-[3,3,4,4,5,5-hexafluoro-2-[(2R)-6-methoxy-2-(4-methoxyphenyl)-2,3-dihydro-1-benzofuran-3-yl]cyclopenten-1-yl]-6-methoxy-2-(4-methoxyphenyl)-1-benzofuran (PubChem CID 154023180) has the molecular formula C37H28F6O6 and a molecular weight of 682.61 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-[(2R)-6-methoxy-2-(4-methoxyphenyl)-2,3-dihydro-1-benzofuran-3-yl]cyclopenten-1-yl]-6-methoxy-2-(4-methoxyphenyl)-1-benzofuran.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-[(2R)-6-methoxy-2-(4-methoxyphenyl)-2,3-dihydro-1-benzofuran-3-yl]cyclopenten-1-yl]-6-methoxy-2-(4-methoxyphenyl)-1-benzofuran |
|---|---|
| PubChem CID | 154023180 |
| Molecular Formula | C37H28F6O6 |
| Molecular Weight | 682.61 g/mol |
| Exact Mass | 682.18 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-[(2R)-6-methoxy-2-(4-methoxyphenyl)-2,3-dihydro-1-benzofuran-3-yl]cyclopenten-1-yl]-6-methoxy-2-(4-methoxyphenyl)-1-benzofuran |
| SMILES | COc1ccc(-c2oc3cc(OC)ccc3c2C2=C(C3c4ccc(OC)cc4O[C@H]3c3ccc(OC)cc3)C(F)(F)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C37H28F6O6/c1-44-21-9-5-19(6-10-21)33-29(25-15-13-23(46-3)17-27(25)48-33)31-32(36(40,41)37(42,43)35(31,38)39)30-26-16-14-24(47-4)18-28(26)49-34(30)20-7-11-22(45-2)12-8-20/h5-18,29,33H,1-4H3/t29?,33-/m0/s1 |
| InChIKey | UAYRNDZKGDNFHV-CJEZNJPTSA-N |
| XLogP | 9.72 |
| TPSA | 59.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.61 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|