About 9H-benzo[7]annulen-2-yl 2,2-dimethylpropanoate
9H-benzo[7]annulen-2-yl 2,2-dimethylpropanoate (PubChem CID 154023588) has the molecular formula C16H18O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is 9H-benzo[7]annulen-2-yl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | 9H-benzo[7]annulen-2-yl 2,2-dimethylpropanoate |
| PubChem CID | 154023588 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 9H-benzo[7]annulen-2-yl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc2c(c1)CC=CC=C2 |
| InChI | InChI=1S/C16H18O2/c1-16(2,3)15(17)18-14-10-9-12-7-5-4-6-8-13(12)11-14/h4-7,9-11H,8H2,1-3H3 |
| InChIKey | YLLFLBRPEYKLKZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 9H-benzo[7]annulen-2-yl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-benzo[7]annulen-2-yl 2,2-dimethylpropanoate?
The IUPAC name of 9H-benzo[7]annulen-2-yl 2,2-dimethylpropanoate (CID 154023588) is 9H-benzo[7]annulen-2-yl 2,2-dimethylpropanoate.
What is the SMILES notation for 9H-benzo[7]annulen-2-yl 2,2-dimethylpropanoate?
The canonical SMILES for 9H-benzo[7]annulen-2-yl 2,2-dimethylpropanoate is CC(C)(C)C(=O)Oc1ccc2c(c1)CC=CC=C2.
What is the InChIKey of 9H-benzo[7]annulen-2-yl 2,2-dimethylpropanoate?
The InChIKey is YLLFLBRPEYKLKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O2/c1-16(2,3)15(17)18-14-10-9-12-7-5-4-6-8-13(12)11-14/h4-7,9-11H,8H2,1-3H3.
What are the key properties of 9H-benzo[7]annulen-2-yl 2,2-dimethylpropanoate?
9H-benzo[7]annulen-2-yl 2,2-dimethylpropanoate has a molecular weight of 242.32 g/mol, XLogP of 3.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-benzo[7]annulen-2-yl 2,2-dimethylpropanoate is sourced from PubChem (CID 154023588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).