C13H20IN3O — CID 154026036
N-[5-(dimethylamino)pentyl]-5-(123I)iodopyridine-2-carboxamide (PubChem CID 154026036) has the molecular formula C13H20IN3O and a molecular weight of 357.23 g/mol. Its IUPAC name is N-[5-(dimethylamino)pentyl]-5-(123I)iodopyridine-2-carboxamide.
| Compound Name | N-[5-(dimethylamino)pentyl]-5-(123I)iodopyridine-2-carboxamide |
|---|---|
| PubChem CID | 154026036 |
| Molecular Formula | C13H20IN3O |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | N-[5-(dimethylamino)pentyl]-5-(123I)iodopyridine-2-carboxamide |
| SMILES | CN(C)CCCCCNC(=O)c1ccc([123I])cn1 |
| InChI | InChI=1S/C13H20IN3O/c1-17(2)9-5-3-4-8-15-13(18)12-7-6-11(14)10-16-12/h6-7,10H,3-5,8-9H2,1-2H3,(H,15,18)/i14-4 |
| InChIKey | RJVVDBQTPPALMF-CKVWVWRJSA-N |
| XLogP | 2.15 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|