About (2E)-N-(trifluoromethylsulfonyl)hexa-2,5-dienamide
(2E)-N-(trifluoromethylsulfonyl)hexa-2,5-dienamide (PubChem CID 154028058) has the molecular formula C7H8F3NO3S
and a molecular weight of 243.21 g/mol. Its IUPAC name is (2E)-N-(trifluoromethylsulfonyl)hexa-2,5-dienamide.
Molecular Properties
| Compound Name | (2E)-N-(trifluoromethylsulfonyl)hexa-2,5-dienamide |
| PubChem CID | 154028058 |
| Molecular Formula | C7H8F3NO3S |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | (2E)-N-(trifluoromethylsulfonyl)hexa-2,5-dienamide |
| SMILES | C=CC/C=C/C(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H8F3NO3S/c1-2-3-4-5-6(12)11-15(13,14)7(8,9)10/h2,4-5H,1,3H2,(H,11,12)/b5-4+ |
| InChIKey | YNYCBXBDBAMPPS-SNAWJCMRSA-N |
| XLogP | 1.08 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-(trifluoromethylsulfonyl)hexa-2,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-(trifluoromethylsulfonyl)hexa-2,5-dienamide?
The IUPAC name of (2E)-N-(trifluoromethylsulfonyl)hexa-2,5-dienamide (CID 154028058) is (2E)-N-(trifluoromethylsulfonyl)hexa-2,5-dienamide.
What is the SMILES notation for (2E)-N-(trifluoromethylsulfonyl)hexa-2,5-dienamide?
The canonical SMILES for (2E)-N-(trifluoromethylsulfonyl)hexa-2,5-dienamide is C=CC/C=C/C(=O)NS(=O)(=O)C(F)(F)F.
What is the InChIKey of (2E)-N-(trifluoromethylsulfonyl)hexa-2,5-dienamide?
The InChIKey is YNYCBXBDBAMPPS-SNAWJCMRSA-N. The full InChI is InChI=1S/C7H8F3NO3S/c1-2-3-4-5-6(12)11-15(13,14)7(8,9)10/h2,4-5H,1,3H2,(H,11,12)/b5-4+.
What are the key properties of (2E)-N-(trifluoromethylsulfonyl)hexa-2,5-dienamide?
(2E)-N-(trifluoromethylsulfonyl)hexa-2,5-dienamide has a molecular weight of 243.21 g/mol, XLogP of 1.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-(trifluoromethylsulfonyl)hexa-2,5-dienamide is sourced from PubChem (CID 154028058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).