C8H8F3NO3S — CID 154028060
(2E,4E)-N-(trifluoromethylsulfonyl)hepta-2,4,6-trienamide (PubChem CID 154028060) has the molecular formula C8H8F3NO3S and a molecular weight of 255.22 g/mol. Its IUPAC name is (2E,4E)-N-(trifluoromethylsulfonyl)hepta-2,4,6-trienamide.
| Compound Name | (2E,4E)-N-(trifluoromethylsulfonyl)hepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 154028060 |
| Molecular Formula | C8H8F3NO3S |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | (2E,4E)-N-(trifluoromethylsulfonyl)hepta-2,4,6-trienamide |
| SMILES | C=C/C=C/C=C/C(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO3S/c1-2-3-4-5-6-7(13)12-16(14,15)8(9,10)11/h2-6H,1H2,(H,12,13)/b4-3+,6-5+ |
| InChIKey | VYBMATNTTYZCLG-VNKDHWASSA-N |
| XLogP | 1.25 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|