C36H10N12 — CID 154028898
[2,7-dicyano-3,6-bis(2,3-dicyanoquinoxalin-6-yl)fluoren-9-ylidene]cyanamide (PubChem CID 154028898) has the molecular formula C36H10N12 and a molecular weight of 610.56 g/mol. Its IUPAC name is [2,7-dicyano-3,6-bis(2,3-dicyanoquinoxalin-6-yl)fluoren-9-ylidene]cyanamide.
| Compound Name | [2,7-dicyano-3,6-bis(2,3-dicyanoquinoxalin-6-yl)fluoren-9-ylidene]cyanamide |
|---|---|
| PubChem CID | 154028898 |
| Molecular Formula | C36H10N12 |
| Molecular Weight | 610.56 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | [2,7-dicyano-3,6-bis(2,3-dicyanoquinoxalin-6-yl)fluoren-9-ylidene]cyanamide |
| SMILES | N#CN=C1c2cc(C#N)c(-c3ccc4nc(C#N)c(C#N)nc4c3)cc2-c2cc(-c3ccc4nc(C#N)c(C#N)nc4c3)c(C#N)cc21 |
| InChI | InChI=1S/C36H10N12/c37-11-20-5-26-24(9-22(20)18-1-3-28-30(7-18)47-34(15-41)32(13-39)45-28)25-10-23(21(12-38)6-27(25)36(26)44-17-43)19-2-4-29-31(8-19)48-35(16-42)33(14-40)46-29/h1-10H |
| InChIKey | NMXZFYMFQZIXBO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 230.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.56 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|