C16H17ClN4O4S — CID 154029246
(2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1S)-1-(5-chlorothiophen-2-yl)-1-hydroxyethyl]oxolane-3,4-diol (PubChem CID 154029246) has the molecular formula C16H17ClN4O4S and a molecular weight of 396.86 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1S)-1-(5-chlorothiophen-2-yl)-1-hydroxyethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1S)-1-(5-chlorothiophen-2-yl)-1-hydroxyethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 154029246 |
| Molecular Formula | C16H17ClN4O4S |
| Molecular Weight | 396.86 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | (2R,3R,4S,5S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1S)-1-(5-chlorothiophen-2-yl)-1-hydroxyethyl]oxolane-3,4-diol |
| SMILES | C[C@@](O)(c1ccc(Cl)s1)[C@H]1O[C@@H](n2ccc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H17ClN4O4S/c1-16(24,8-2-3-9(17)26-8)12-10(22)11(23)15(25-12)21-5-4-7-13(18)19-6-20-14(7)21/h2-6,10-12,15,22-24H,1H3,(H2,18,19,20)/t10-,11+,12-,15+,16+/m0/s1 |
| InChIKey | BEWFVLYVAWLKQZ-SCYJSFNGSA-N |
| XLogP | 1.26 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.86 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |