About indene-2,2-dicarbonitrile
indene-2,2-dicarbonitrile (PubChem CID 154029382) has the molecular formula C11H6N2
and a molecular weight of 166.18 g/mol. Its IUPAC name is indene-2,2-dicarbonitrile.
Molecular Properties
| Compound Name | indene-2,2-dicarbonitrile |
| PubChem CID | 154029382 |
| Molecular Formula | C11H6N2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | indene-2,2-dicarbonitrile |
| SMILES | N#CC1(C#N)C=c2ccccc2=C1 |
| InChI | InChI=1S/C11H6N2/c12-7-11(8-13)5-9-3-1-2-4-10(9)6-11/h1-6H |
| InChIKey | DEHWMKMZSVNZKT-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze indene-2,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indene-2,2-dicarbonitrile?
The IUPAC name of indene-2,2-dicarbonitrile (CID 154029382) is indene-2,2-dicarbonitrile.
What is the SMILES notation for indene-2,2-dicarbonitrile?
The canonical SMILES for indene-2,2-dicarbonitrile is N#CC1(C#N)C=c2ccccc2=C1.
What is the InChIKey of indene-2,2-dicarbonitrile?
The InChIKey is DEHWMKMZSVNZKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N2/c12-7-11(8-13)5-9-3-1-2-4-10(9)6-11/h1-6H.
What are the key properties of indene-2,2-dicarbonitrile?
indene-2,2-dicarbonitrile has a molecular weight of 166.18 g/mol, XLogP of 0.29, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indene-2,2-dicarbonitrile is sourced from PubChem (CID 154029382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).