About cyclohexa-2,6-diene-1,2-dicarbonitrile
cyclohexa-2,6-diene-1,2-dicarbonitrile (PubChem CID 154029388) has the molecular formula C8H6N2
and a molecular weight of 130.15 g/mol. Its IUPAC name is cyclohexa-2,6-diene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | cyclohexa-2,6-diene-1,2-dicarbonitrile |
| PubChem CID | 154029388 |
| Molecular Formula | C8H6N2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | cyclohexa-2,6-diene-1,2-dicarbonitrile |
| SMILES | N#CC1=CCCC=C1C#N |
| InChI | InChI=1S/C8H6N2/c9-5-7-3-1-2-4-8(7)6-10/h3-4H,1-2H2 |
| InChIKey | DSYUTCCLWJFTNM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexa-2,6-diene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,6-diene-1,2-dicarbonitrile?
The IUPAC name of cyclohexa-2,6-diene-1,2-dicarbonitrile (CID 154029388) is cyclohexa-2,6-diene-1,2-dicarbonitrile.
What is the SMILES notation for cyclohexa-2,6-diene-1,2-dicarbonitrile?
The canonical SMILES for cyclohexa-2,6-diene-1,2-dicarbonitrile is N#CC1=CCCC=C1C#N.
What is the InChIKey of cyclohexa-2,6-diene-1,2-dicarbonitrile?
The InChIKey is DSYUTCCLWJFTNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2/c9-5-7-3-1-2-4-8(7)6-10/h3-4H,1-2H2.
What are the key properties of cyclohexa-2,6-diene-1,2-dicarbonitrile?
cyclohexa-2,6-diene-1,2-dicarbonitrile has a molecular weight of 130.15 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,6-diene-1,2-dicarbonitrile is sourced from PubChem (CID 154029388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).