C24H33N7O6 — CID 154029532
(2S)-2-[[4-[(2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxo-5-pentoxypentanoic acid (PubChem CID 154029532) has the molecular formula C24H33N7O6 and a molecular weight of 515.57 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxo-5-pentoxypentanoic acid.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxo-5-pentoxypentanoic acid |
|---|---|
| PubChem CID | 154029532 |
| Molecular Formula | C24H33N7O6 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-oxo-5-pentoxypentanoic acid |
| SMILES | CCCCCOC(=O)CC[C@H](NC(=O)c1ccc(NCC2CNc3nc(N)[nH]c(=O)c3N2)cc1)C(=O)O |
| InChI | InChI=1S/C24H33N7O6/c1-2-3-4-11-37-18(32)10-9-17(23(35)36)29-21(33)14-5-7-15(8-6-14)26-12-16-13-27-20-19(28-16)22(34)31-24(25)30-20/h5-8,16-17,26,28H,2-4,9-13H2,1H3,(H,29,33)(H,35,36)(H4,25,27,30,31,34)/t16?,17-/m0/s1 |
| InChIKey | AKXNJXWRIOWRPF-DJNXLDHESA-N |
| XLogP | 1.37 |
| TPSA | 200.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|