About 5,5-dimethyl-6a-phenyl-3-trimethylsilyl-6H-furo[3,2-b]furan-2-one
5,5-dimethyl-6a-phenyl-3-trimethylsilyl-6H-furo[3,2-b]furan-2-one (PubChem CID 154031740) has the molecular formula C17H22O3Si
and a molecular weight of 302.45 g/mol. Its IUPAC name is 5,5-dimethyl-6a-phenyl-3-trimethylsilyl-6H-furo[3,2-b]furan-2-one.
Molecular Properties
| Compound Name | 5,5-dimethyl-6a-phenyl-3-trimethylsilyl-6H-furo[3,2-b]furan-2-one |
| PubChem CID | 154031740 |
| Molecular Formula | C17H22O3Si |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 5,5-dimethyl-6a-phenyl-3-trimethylsilyl-6H-furo[3,2-b]furan-2-one |
| SMILES | CC1(C)CC2(c3ccccc3)OC(=O)C([Si](C)(C)C)=C2O1 |
| InChI | InChI=1S/C17H22O3Si/c1-16(2)11-17(12-9-7-6-8-10-12)14(19-16)13(15(18)20-17)21(3,4)5/h6-10H,11H2,1-5H3 |
| InChIKey | YDQJNRVIGWNHBS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-6a-phenyl-3-trimethylsilyl-6H-furo[3,2-b]furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-6a-phenyl-3-trimethylsilyl-6H-furo[3,2-b]furan-2-one?
The IUPAC name of 5,5-dimethyl-6a-phenyl-3-trimethylsilyl-6H-furo[3,2-b]furan-2-one (CID 154031740) is 5,5-dimethyl-6a-phenyl-3-trimethylsilyl-6H-furo[3,2-b]furan-2-one.
What is the SMILES notation for 5,5-dimethyl-6a-phenyl-3-trimethylsilyl-6H-furo[3,2-b]furan-2-one?
The canonical SMILES for 5,5-dimethyl-6a-phenyl-3-trimethylsilyl-6H-furo[3,2-b]furan-2-one is CC1(C)CC2(c3ccccc3)OC(=O)C([Si](C)(C)C)=C2O1.
What is the InChIKey of 5,5-dimethyl-6a-phenyl-3-trimethylsilyl-6H-furo[3,2-b]furan-2-one?
The InChIKey is YDQJNRVIGWNHBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O3Si/c1-16(2)11-17(12-9-7-6-8-10-12)14(19-16)13(15(18)20-17)21(3,4)5/h6-10H,11H2,1-5H3.
What are the key properties of 5,5-dimethyl-6a-phenyl-3-trimethylsilyl-6H-furo[3,2-b]furan-2-one?
5,5-dimethyl-6a-phenyl-3-trimethylsilyl-6H-furo[3,2-b]furan-2-one has a molecular weight of 302.45 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-6a-phenyl-3-trimethylsilyl-6H-furo[3,2-b]furan-2-one is sourced from PubChem (CID 154031740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).