C51H73NOSi — CID 154031906
2-(2,7-ditert-butylcarbazol-9-yl)-6-[3-[dimethyl(octyl)silyl]-5-methylphenyl]-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 154031906) has the molecular formula C51H73NOSi and a molecular weight of 744.24 g/mol. Its IUPAC name is 2-(2,7-ditert-butylcarbazol-9-yl)-6-[3-[dimethyl(octyl)silyl]-5-methylphenyl]-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-(2,7-ditert-butylcarbazol-9-yl)-6-[3-[dimethyl(octyl)silyl]-5-methylphenyl]-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 154031906 |
| Molecular Formula | C51H73NOSi |
| Molecular Weight | 744.24 g/mol |
| Exact Mass | 743.55 |
| IUPAC Name | 2-(2,7-ditert-butylcarbazol-9-yl)-6-[3-[dimethyl(octyl)silyl]-5-methylphenyl]-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CCCCCCCC[Si](C)(C)c1cc(C)cc(-c2cc(C(C)(C)CC(C)(C)C)cc(-n3c4cc(C(C)(C)C)ccc4c4ccc(C(C)(C)C)cc43)c2O)c1 |
| InChI | InChI=1S/C51H73NOSi/c1-16-17-18-19-20-21-26-54(14,15)40-28-35(2)27-36(29-40)43-30-39(51(12,13)34-48(3,4)5)33-46(47(43)53)52-44-31-37(49(6,7)8)22-24-41(44)42-25-23-38(32-45(42)52)50(9,10)11/h22-25,27-33,53H,16-21,26,34H2,1-15H3 |
| InChIKey | JDMCMJDNOHHIPN-UHFFFAOYSA-N |
| XLogP | 15.05 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.24 |
| LogP ≤ 5 | 15.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|