C28H29N5O9 — CID 154032284
dimethyl (2S)-2-[[2-[3-[[1-methyl-4-[(3-nitrobenzoyl)amino]pyrrole-2-carbonyl]amino]phenyl]acetyl]amino]pentanedioate (PubChem CID 154032284) has the molecular formula C28H29N5O9 and a molecular weight of 579.57 g/mol. Its IUPAC name is dimethyl (2S)-2-[[2-[3-[[1-methyl-4-[(3-nitrobenzoyl)amino]pyrrole-2-carbonyl]amino]phenyl]acetyl]amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[[2-[3-[[1-methyl-4-[(3-nitrobenzoyl)amino]pyrrole-2-carbonyl]amino]phenyl]acetyl]amino]pentanedioate |
|---|---|
| PubChem CID | 154032284 |
| Molecular Formula | C28H29N5O9 |
| Molecular Weight | 579.57 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | dimethyl (2S)-2-[[2-[3-[[1-methyl-4-[(3-nitrobenzoyl)amino]pyrrole-2-carbonyl]amino]phenyl]acetyl]amino]pentanedioate |
| SMILES | COC(=O)CC[C@H](NC(=O)Cc1cccc(NC(=O)c2cc(NC(=O)c3cccc([N+](=O)[O-])c3)cn2C)c1)C(=O)OC |
| InChI | InChI=1S/C28H29N5O9/c1-32-16-20(30-26(36)18-7-5-9-21(14-18)33(39)40)15-23(32)27(37)29-19-8-4-6-17(12-19)13-24(34)31-22(28(38)42-3)10-11-25(35)41-2/h4-9,12,14-16,22H,10-11,13H2,1-3H3,(H,29,37)(H,30,36)(H,31,34)/t22-/m0/s1 |
| InChIKey | HJGVBNGPJFYIEG-QFIPXVFZSA-N |
| XLogP | 2.59 |
| TPSA | 187.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|