About 2,2-dimethylpropyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate
2,2-dimethylpropyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate (PubChem CID 154032403) has the molecular formula C16H16ClN3O2
and a molecular weight of 317.78 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate.
Molecular Properties
| Compound Name | 2,2-dimethylpropyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate |
| PubChem CID | 154032403 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2,2-dimethylpropyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate |
| SMILES | CC(C)(C)COC(=O)/C(C#N)=C1\Nc2ccccc2N=C1Cl |
| InChI | InChI=1S/C16H16ClN3O2/c1-16(2,3)9-22-15(21)10(8-18)13-14(17)20-12-7-5-4-6-11(12)19-13/h4-7,19H,9H2,1-3H3/b13-10- |
| InChIKey | UOZIUBSTDANXAF-RAXLEYEMSA-N |
| XLogP | 3.75 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate?
The IUPAC name of 2,2-dimethylpropyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate (CID 154032403) is 2,2-dimethylpropyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate.
What is the SMILES notation for 2,2-dimethylpropyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate?
The canonical SMILES for 2,2-dimethylpropyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate is CC(C)(C)COC(=O)/C(C#N)=C1\Nc2ccccc2N=C1Cl.
What is the InChIKey of 2,2-dimethylpropyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate?
The InChIKey is UOZIUBSTDANXAF-RAXLEYEMSA-N. The full InChI is InChI=1S/C16H16ClN3O2/c1-16(2,3)9-22-15(21)10(8-18)13-14(17)20-12-7-5-4-6-11(12)19-13/h4-7,19H,9H2,1-3H3/b13-10-.
What are the key properties of 2,2-dimethylpropyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate?
2,2-dimethylpropyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate has a molecular weight of 317.78 g/mol, XLogP of 3.75, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropyl (2Z)-2-(3-chloro-1H-quinoxalin-2-ylidene)-2-cyanoacetate is sourced from PubChem (CID 154032403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).