C17H27NO9 — CID 15403437
methyl (3R,4S,5R,7S)-4-acetamido-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-7-methoxy-1,6-dioxaspiro[2.5]octane-7-carboxylate (PubChem CID 15403437) has the molecular formula C17H27NO9 and a molecular weight of 389.40 g/mol. Its IUPAC name is methyl (3R,4S,5R,7S)-4-acetamido-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-7-methoxy-1,6-dioxaspiro[2.5]octane-7-carboxylate.
| Compound Name | methyl (3R,4S,5R,7S)-4-acetamido-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-7-methoxy-1,6-dioxaspiro[2.5]octane-7-carboxylate |
|---|---|
| PubChem CID | 15403437 |
| Molecular Formula | C17H27NO9 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | methyl (3R,4S,5R,7S)-4-acetamido-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-7-methoxy-1,6-dioxaspiro[2.5]octane-7-carboxylate |
| SMILES | COC(=O)[C@]1(OC)C[C@]2(CO2)[C@@H](NC(C)=O)[C@H]([C@@H](O)[C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C17H27NO9/c1-9(19)18-13-12(11(20)10-6-24-15(2,3)26-10)27-17(23-5,14(21)22-4)7-16(13)8-25-16/h10-13,20H,6-8H2,1-5H3,(H,18,19)/t10-,11+,12+,13+,16+,17+/m1/s1 |
| InChIKey | ZSDSRVQBXOWJSP-IAEMXTMZSA-N |
| XLogP | -0.92 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|