About 6-sulfonyl-1H-pyrimidine
6-sulfonyl-1H-pyrimidine (PubChem CID 154036279) has the molecular formula C4H4N2O2S
and a molecular weight of 144.16 g/mol. Its IUPAC name is 6-sulfonyl-1H-pyrimidine.
Molecular Properties
| Compound Name | 6-sulfonyl-1H-pyrimidine |
| PubChem CID | 154036279 |
| Molecular Formula | C4H4N2O2S |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.00 |
| IUPAC Name | 6-sulfonyl-1H-pyrimidine |
| SMILES | O=S(=O)=c1ccnc[nH]1 |
| InChI | InChI=1S/C4H4N2O2S/c7-9(8)4-1-2-5-3-6-4/h1-3H,(H,5,6) |
| InChIKey | KFMQZGMHNJBTRT-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-sulfonyl-1H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-sulfonyl-1H-pyrimidine?
The IUPAC name of 6-sulfonyl-1H-pyrimidine (CID 154036279) is 6-sulfonyl-1H-pyrimidine.
What is the SMILES notation for 6-sulfonyl-1H-pyrimidine?
The canonical SMILES for 6-sulfonyl-1H-pyrimidine is O=S(=O)=c1ccnc[nH]1.
What is the InChIKey of 6-sulfonyl-1H-pyrimidine?
The InChIKey is KFMQZGMHNJBTRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2S/c7-9(8)4-1-2-5-3-6-4/h1-3H,(H,5,6).
What are the key properties of 6-sulfonyl-1H-pyrimidine?
6-sulfonyl-1H-pyrimidine has a molecular weight of 144.16 g/mol, XLogP of -0.18, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-sulfonyl-1H-pyrimidine is sourced from PubChem (CID 154036279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).