About [(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl] acetate
[(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl] acetate (PubChem CID 15403703) has the molecular formula C13H23FO4Si
and a molecular weight of 290.41 g/mol. Its IUPAC name is [(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl] acetate.
Molecular Properties
| Compound Name | [(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl] acetate |
| PubChem CID | 15403703 |
| Molecular Formula | C13H23FO4Si |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl] acetate |
| SMILES | CC(=O)OC1O[C@@H](CO[Si](C)(C)C(C)(C)C)C=C1F |
| InChI | InChI=1S/C13H23FO4Si/c1-9(15)17-12-11(14)7-10(18-12)8-16-19(5,6)13(2,3)4/h7,10,12H,8H2,1-6H3/t10-,12?/m1/s1 |
| InChIKey | SHLYEYBTCIQUQX-RWANSRKNSA-N |
| XLogP | 3.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl] acetate?
The IUPAC name of [(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl] acetate (CID 15403703) is [(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl] acetate.
What is the SMILES notation for [(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl] acetate?
The canonical SMILES for [(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl] acetate is CC(=O)OC1O[C@@H](CO[Si](C)(C)C(C)(C)C)C=C1F.
What is the InChIKey of [(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl] acetate?
The InChIKey is SHLYEYBTCIQUQX-RWANSRKNSA-N. The full InChI is InChI=1S/C13H23FO4Si/c1-9(15)17-12-11(14)7-10(18-12)8-16-19(5,6)13(2,3)4/h7,10,12H,8H2,1-6H3/t10-,12?/m1/s1.
What are the key properties of [(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl] acetate?
[(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl] acetate has a molecular weight of 290.41 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2,5-dihydrofuran-2-yl] acetate is sourced from PubChem (CID 15403703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).