C24H24F4N2OS — CID 154037256
N'-[2,5-dimethyl-4-[3-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)sulfanylphenoxy]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 154037256) has the molecular formula C24H24F4N2OS and a molecular weight of 464.53 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[3-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)sulfanylphenoxy]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-[3-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)sulfanylphenoxy]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 154037256 |
| Molecular Formula | C24H24F4N2OS |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N'-[2,5-dimethyl-4-[3-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)sulfanylphenoxy]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2cccc(SC3=CC=CC(F)(F)C3(F)F)c2)cc1C |
| InChI | InChI=1S/C24H24F4N2OS/c1-5-30(4)15-29-20-12-17(3)21(13-16(20)2)31-18-8-6-9-19(14-18)32-22-10-7-11-23(25,26)24(22,27)28/h6-15H,5H2,1-4H3/b29-15+ |
| InChIKey | VKVWRZUGIPPMED-WKULSOCRSA-N |
| XLogP | 7.52 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|