C5H5NO2 — CID 154037475
1-cyclopropylaziridine-2,3-dione (PubChem CID 154037475) has the molecular formula C5H5NO2 and a molecular weight of 111.10 g/mol. Its IUPAC name is 1-cyclopropylaziridine-2,3-dione.
| Compound Name | 1-cyclopropylaziridine-2,3-dione |
|---|---|
| PubChem CID | 154037475 |
| Molecular Formula | C5H5NO2 |
| Molecular Weight | 111.10 g/mol |
| Exact Mass | 111.03 |
| IUPAC Name | 1-cyclopropylaziridine-2,3-dione |
| SMILES | O=c1c(=O)n1C1CC1 |
| InChI | InChI=1S/C5H5NO2/c7-4-5(8)6(4)3-1-2-3/h3H,1-2H2 |
| InChIKey | WECBJQMZLDNBRE-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.10 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|