C18H14F6N2O2 — CID 154037515
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,3-dihydro-1H-isoindole-1-carboxamide (PubChem CID 154037515) has the molecular formula C18H14F6N2O2 and a molecular weight of 404.31 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,3-dihydro-1H-isoindole-1-carboxamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,3-dihydro-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 154037515 |
| Molecular Formula | C18H14F6N2O2 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,3-dihydro-1H-isoindole-1-carboxamide |
| SMILES | O=C(Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)C1NCc2ccccc21 |
| InChI | InChI=1S/C18H14F6N2O2/c19-17(20,21)16(28,18(22,23)24)11-5-7-12(8-6-11)26-15(27)14-13-4-2-1-3-10(13)9-25-14/h1-8,14,25,28H,9H2,(H,26,27) |
| InChIKey | XMNCVRJHIJEZEX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |