C12H10F3NS — CID 154037678
4-[4-(trifluoromethylsulfanyl)phenyl]-2,3-dihydropyridine (PubChem CID 154037678) has the molecular formula C12H10F3NS and a molecular weight of 257.28 g/mol. Its IUPAC name is 4-[4-(trifluoromethylsulfanyl)phenyl]-2,3-dihydropyridine.
| Compound Name | 4-[4-(trifluoromethylsulfanyl)phenyl]-2,3-dihydropyridine |
|---|---|
| PubChem CID | 154037678 |
| Molecular Formula | C12H10F3NS |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 4-[4-(trifluoromethylsulfanyl)phenyl]-2,3-dihydropyridine |
| SMILES | FC(F)(F)Sc1ccc(C2=CC=NCC2)cc1 |
| InChI | InChI=1S/C12H10F3NS/c13-12(14,15)17-11-3-1-9(2-4-11)10-5-7-16-8-6-10/h1-5,7H,6,8H2 |
| InChIKey | NQPZXDBVTJFYIQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |