About 2-chloro-8-methyl-4H-1,3,2-benzodioxaphosphinine
2-chloro-8-methyl-4H-1,3,2-benzodioxaphosphinine (PubChem CID 15403802) has the molecular formula C8H8ClO2P
and a molecular weight of 202.58 g/mol. Its IUPAC name is 2-chloro-8-methyl-4H-1,3,2-benzodioxaphosphinine.
Molecular Properties
| Compound Name | 2-chloro-8-methyl-4H-1,3,2-benzodioxaphosphinine |
| PubChem CID | 15403802 |
| Molecular Formula | C8H8ClO2P |
| Molecular Weight | 202.58 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | 2-chloro-8-methyl-4H-1,3,2-benzodioxaphosphinine |
| SMILES | Cc1cccc2c1OP(Cl)OC2 |
| InChI | InChI=1S/C8H8ClO2P/c1-6-3-2-4-7-5-10-12(9)11-8(6)7/h2-4H,5H2,1H3 |
| InChIKey | MLOZFJWYOHVQQS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.58 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-8-methyl-4H-1,3,2-benzodioxaphosphinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-8-methyl-4H-1,3,2-benzodioxaphosphinine?
The IUPAC name of 2-chloro-8-methyl-4H-1,3,2-benzodioxaphosphinine (CID 15403802) is 2-chloro-8-methyl-4H-1,3,2-benzodioxaphosphinine.
What is the SMILES notation for 2-chloro-8-methyl-4H-1,3,2-benzodioxaphosphinine?
The canonical SMILES for 2-chloro-8-methyl-4H-1,3,2-benzodioxaphosphinine is Cc1cccc2c1OP(Cl)OC2.
What is the InChIKey of 2-chloro-8-methyl-4H-1,3,2-benzodioxaphosphinine?
The InChIKey is MLOZFJWYOHVQQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClO2P/c1-6-3-2-4-7-5-10-12(9)11-8(6)7/h2-4H,5H2,1H3.
What are the key properties of 2-chloro-8-methyl-4H-1,3,2-benzodioxaphosphinine?
2-chloro-8-methyl-4H-1,3,2-benzodioxaphosphinine has a molecular weight of 202.58 g/mol, XLogP of 3.37, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-8-methyl-4H-1,3,2-benzodioxaphosphinine is sourced from PubChem (CID 15403802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).