About 3-N-methylsulfanylbutane-2,3-diimine
3-N-methylsulfanylbutane-2,3-diimine (PubChem CID 154038933) has the molecular formula C5H10N2S
and a molecular weight of 130.22 g/mol. Its IUPAC name is 3-N-methylsulfanylbutane-2,3-diimine.
Molecular Properties
| Compound Name | 3-N-methylsulfanylbutane-2,3-diimine |
| PubChem CID | 154038933 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 3-N-methylsulfanylbutane-2,3-diimine |
| SMILES | [H]/N=C(\C)C(C)=NSC |
| InChI | InChI=1S/C5H10N2S/c1-4(6)5(2)7-8-3/h6H,1-3H3/b6-4+,7-5? |
| InChIKey | ZJVONKLAPFZTBM-NNUXYFOWSA-N |
| XLogP | 1.76 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-N-methylsulfanylbutane-2,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-methylsulfanylbutane-2,3-diimine?
The IUPAC name of 3-N-methylsulfanylbutane-2,3-diimine (CID 154038933) is 3-N-methylsulfanylbutane-2,3-diimine.
What is the SMILES notation for 3-N-methylsulfanylbutane-2,3-diimine?
The canonical SMILES for 3-N-methylsulfanylbutane-2,3-diimine is [H]/N=C(\C)C(C)=NSC.
What is the InChIKey of 3-N-methylsulfanylbutane-2,3-diimine?
The InChIKey is ZJVONKLAPFZTBM-NNUXYFOWSA-N. The full InChI is InChI=1S/C5H10N2S/c1-4(6)5(2)7-8-3/h6H,1-3H3/b6-4+,7-5?.
What are the key properties of 3-N-methylsulfanylbutane-2,3-diimine?
3-N-methylsulfanylbutane-2,3-diimine has a molecular weight of 130.22 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-methylsulfanylbutane-2,3-diimine is sourced from PubChem (CID 154038933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).