About N'-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-enimidamide
N'-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-enimidamide (PubChem CID 154039416) has the molecular formula C6H8N4S
and a molecular weight of 168.22 g/mol. Its IUPAC name is N'-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-enimidamide.
Molecular Properties
| Compound Name | N'-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-enimidamide |
| PubChem CID | 154039416 |
| Molecular Formula | C6H8N4S |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | N'-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-enimidamide |
| SMILES | C=CC(N)=Nc1nc(C)ns1 |
| InChI | InChI=1S/C6H8N4S/c1-3-5(7)9-6-8-4(2)10-11-6/h3H,1H2,2H3,(H2,7,8,9,10) |
| InChIKey | XZLBUPBCILAEBN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-enimidamide?
The IUPAC name of N'-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-enimidamide (CID 154039416) is N'-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-enimidamide.
What is the SMILES notation for N'-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-enimidamide?
The canonical SMILES for N'-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-enimidamide is C=CC(N)=Nc1nc(C)ns1.
What is the InChIKey of N'-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-enimidamide?
The InChIKey is XZLBUPBCILAEBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4S/c1-3-5(7)9-6-8-4(2)10-11-6/h3H,1H2,2H3,(H2,7,8,9,10).
What are the key properties of N'-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-enimidamide?
N'-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-enimidamide has a molecular weight of 168.22 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-methyl-1,2,4-thiadiazol-5-yl)prop-2-enimidamide is sourced from PubChem (CID 154039416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).