About 3-methylideneheptane
3-methylideneheptane (PubChem CID 15404) has the molecular formula C8H16
and a molecular weight of 112.22 g/mol. Its IUPAC name is 3-methylideneheptane.
Molecular Properties
| Compound Name | 3-methylideneheptane |
| PubChem CID | 15404 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.22 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | 3-methylideneheptane |
| SMILES | C=C(CC)CCCC |
| InChI | InChI=1S/C8H16/c1-4-6-7-8(3)5-2/h3-7H2,1-2H3 |
| InChIKey | XTVRLCUJHGUXCP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylideneheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylideneheptane?
The IUPAC name of 3-methylideneheptane (CID 15404) is 3-methylideneheptane.
What is the SMILES notation for 3-methylideneheptane?
The canonical SMILES for 3-methylideneheptane is C=C(CC)CCCC.
What is the InChIKey of 3-methylideneheptane?
The InChIKey is XTVRLCUJHGUXCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16/c1-4-6-7-8(3)5-2/h3-7H2,1-2H3.
What are the key properties of 3-methylideneheptane?
3-methylideneheptane has a molecular weight of 112.22 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylideneheptane is sourced from PubChem (CID 15404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).