C14H22NO2P — CID 15404022
8-methyl-N,N-di(propan-2-yl)-4H-1,3,2-benzodioxaphosphinin-2-amine (PubChem CID 15404022) has the molecular formula C14H22NO2P and a molecular weight of 267.31 g/mol. Its IUPAC name is 8-methyl-N,N-di(propan-2-yl)-4H-1,3,2-benzodioxaphosphinin-2-amine.
| Compound Name | 8-methyl-N,N-di(propan-2-yl)-4H-1,3,2-benzodioxaphosphinin-2-amine |
|---|---|
| PubChem CID | 15404022 |
| Molecular Formula | C14H22NO2P |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 8-methyl-N,N-di(propan-2-yl)-4H-1,3,2-benzodioxaphosphinin-2-amine |
| SMILES | Cc1cccc2c1OP(N(C(C)C)C(C)C)OC2 |
| InChI | InChI=1S/C14H22NO2P/c1-10(2)15(11(3)4)18-16-9-13-8-6-7-12(5)14(13)17-18/h6-8,10-11H,9H2,1-5H3 |
| InChIKey | CHXAEQZAWMDHLL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|